C20H29ClO3S — CID 143180570
(3R)-9-tert-butyl-3-[(4-chlorophenyl)sulfanylmethyl]-3-methyl-1,2,5-trioxaspiro[5.5]undecane (PubChem CID 143180570) has the molecular formula C20H29ClO3S and a molecular weight of 384.97 g/mol. Its IUPAC name is (3R)-9-tert-butyl-3-[(4-chlorophenyl)sulfanylmethyl]-3-methyl-1,2,5-trioxaspiro[5.5]undecane.
| Compound Name | (3R)-9-tert-butyl-3-[(4-chlorophenyl)sulfanylmethyl]-3-methyl-1,2,5-trioxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 143180570 |
| Molecular Formula | C20H29ClO3S |
| Molecular Weight | 384.97 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | (3R)-9-tert-butyl-3-[(4-chlorophenyl)sulfanylmethyl]-3-methyl-1,2,5-trioxaspiro[5.5]undecane |
| SMILES | CC(C)(C)C1CCC2(CC1)OC[C@](C)(CSc1ccc(Cl)cc1)OO2 |
| InChI | InChI=1S/C20H29ClO3S/c1-18(2,3)15-9-11-20(12-10-15)22-13-19(4,23-24-20)14-25-17-7-5-16(21)6-8-17/h5-8,15H,9-14H2,1-4H3/t15?,19-,20?/m1/s1 |
| InChIKey | WYPDXAUWELNYQJ-KHPNHKCMSA-N |
| XLogP | 6.10 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.97 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|