C16H21ClO3S — CID 11688488
3-[(4-chlorophenyl)sulfanylmethyl]-3-methyl-1,2,5-trioxaspiro[5.5]undecane (PubChem CID 11688488) has the molecular formula C16H21ClO3S and a molecular weight of 328.86 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)sulfanylmethyl]-3-methyl-1,2,5-trioxaspiro[5.5]undecane.
| Compound Name | 3-[(4-chlorophenyl)sulfanylmethyl]-3-methyl-1,2,5-trioxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 11688488 |
| Molecular Formula | C16H21ClO3S |
| Molecular Weight | 328.86 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 3-[(4-chlorophenyl)sulfanylmethyl]-3-methyl-1,2,5-trioxaspiro[5.5]undecane |
| SMILES | CC1(CSc2ccc(Cl)cc2)COC2(CCCCC2)OO1 |
| InChI | InChI=1S/C16H21ClO3S/c1-15(12-21-14-7-5-13(17)6-8-14)11-18-16(20-19-15)9-3-2-4-10-16/h5-8H,2-4,9-12H2,1H3 |
| InChIKey | PVHCLUKMPHPUNF-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.86 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|