C21H31ClO3S — CID 134927967
3-[(4-chlorophenyl)sulfanylmethyl]-3-methyl-1,2,5-trioxaspiro[5.10]hexadecane (PubChem CID 134927967) has the molecular formula C21H31ClO3S and a molecular weight of 399.00 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)sulfanylmethyl]-3-methyl-1,2,5-trioxaspiro[5.10]hexadecane.
| Compound Name | 3-[(4-chlorophenyl)sulfanylmethyl]-3-methyl-1,2,5-trioxaspiro[5.10]hexadecane |
|---|---|
| PubChem CID | 134927967 |
| Molecular Formula | C21H31ClO3S |
| Molecular Weight | 399.00 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 3-[(4-chlorophenyl)sulfanylmethyl]-3-methyl-1,2,5-trioxaspiro[5.10]hexadecane |
| SMILES | CC1(CSc2ccc(Cl)cc2)COC2(CCCCCCCCCC2)OO1 |
| InChI | InChI=1S/C21H31ClO3S/c1-20(17-26-19-12-10-18(22)11-13-19)16-23-21(25-24-20)14-8-6-4-2-3-5-7-9-15-21/h10-13H,2-9,14-17H2,1H3 |
| InChIKey | ACPNKULQXKJTAM-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.00 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|