C21H34O3S — CID 71597172
6-methyl-3,3-dipentyl-6-(phenylsulfanylmethyl)-1,2,4-trioxane (PubChem CID 71597172) has the molecular formula C21H34O3S and a molecular weight of 366.57 g/mol. Its IUPAC name is 6-methyl-3,3-dipentyl-6-(phenylsulfanylmethyl)-1,2,4-trioxane.
| Compound Name | 6-methyl-3,3-dipentyl-6-(phenylsulfanylmethyl)-1,2,4-trioxane |
|---|---|
| PubChem CID | 71597172 |
| Molecular Formula | C21H34O3S |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 6-methyl-3,3-dipentyl-6-(phenylsulfanylmethyl)-1,2,4-trioxane |
| SMILES | CCCCCC1(CCCCC)OCC(C)(CSc2ccccc2)OO1 |
| InChI | InChI=1S/C21H34O3S/c1-4-6-11-15-21(16-12-7-5-2)22-17-20(3,23-24-21)18-25-19-13-9-8-10-14-19/h8-10,13-14H,4-7,11-12,15-18H2,1-3H3 |
| InChIKey | BCCJGYPOZSHCBN-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|