C17H26O3S — CID 71597173
6-methyl-6-(phenylsulfanylmethyl)-3,3-dipropyl-1,2,4-trioxane (PubChem CID 71597173) has the molecular formula C17H26O3S and a molecular weight of 310.46 g/mol. Its IUPAC name is 6-methyl-6-(phenylsulfanylmethyl)-3,3-dipropyl-1,2,4-trioxane.
| Compound Name | 6-methyl-6-(phenylsulfanylmethyl)-3,3-dipropyl-1,2,4-trioxane |
|---|---|
| PubChem CID | 71597173 |
| Molecular Formula | C17H26O3S |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 6-methyl-6-(phenylsulfanylmethyl)-3,3-dipropyl-1,2,4-trioxane |
| SMILES | CCCC1(CCC)OCC(C)(CSc2ccccc2)OO1 |
| InChI | InChI=1S/C17H26O3S/c1-4-11-17(12-5-2)18-13-16(3,19-20-17)14-21-15-9-7-6-8-10-15/h6-10H,4-5,11-14H2,1-3H3 |
| InChIKey | PFMYQXJCICBDHD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|