About 7-methyl-7-(phenylsulfanylmethyl)-5,6,9-trioxaspiro[3.5]nonane
7-methyl-7-(phenylsulfanylmethyl)-5,6,9-trioxaspiro[3.5]nonane (PubChem CID 11323093) has the molecular formula C14H18O3S
and a molecular weight of 266.36 g/mol. Its IUPAC name is 7-methyl-7-(phenylsulfanylmethyl)-5,6,9-trioxaspiro[3.5]nonane.
Molecular Properties
| Compound Name | 7-methyl-7-(phenylsulfanylmethyl)-5,6,9-trioxaspiro[3.5]nonane |
| PubChem CID | 11323093 |
| Molecular Formula | C14H18O3S |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 7-methyl-7-(phenylsulfanylmethyl)-5,6,9-trioxaspiro[3.5]nonane |
| SMILES | CC1(CSc2ccccc2)COC2(CCC2)OO1 |
| InChI | InChI=1S/C14H18O3S/c1-13(11-18-12-6-3-2-4-7-12)10-15-14(17-16-13)8-5-9-14/h2-4,6-7H,5,8-11H2,1H3 |
| InChIKey | AUOVDZGSQAVVKO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 7-methyl-7-(phenylsulfanylmethyl)-5,6,9-trioxaspiro[3.5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-7-(phenylsulfanylmethyl)-5,6,9-trioxaspiro[3.5]nonane?
The IUPAC name of 7-methyl-7-(phenylsulfanylmethyl)-5,6,9-trioxaspiro[3.5]nonane (CID 11323093) is 7-methyl-7-(phenylsulfanylmethyl)-5,6,9-trioxaspiro[3.5]nonane.
What is the SMILES notation for 7-methyl-7-(phenylsulfanylmethyl)-5,6,9-trioxaspiro[3.5]nonane?
The canonical SMILES for 7-methyl-7-(phenylsulfanylmethyl)-5,6,9-trioxaspiro[3.5]nonane is CC1(CSc2ccccc2)COC2(CCC2)OO1.
What is the InChIKey of 7-methyl-7-(phenylsulfanylmethyl)-5,6,9-trioxaspiro[3.5]nonane?
The InChIKey is AUOVDZGSQAVVKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O3S/c1-13(11-18-12-6-3-2-4-7-12)10-15-14(17-16-13)8-5-9-14/h2-4,6-7H,5,8-11H2,1H3.
What are the key properties of 7-methyl-7-(phenylsulfanylmethyl)-5,6,9-trioxaspiro[3.5]nonane?
7-methyl-7-(phenylsulfanylmethyl)-5,6,9-trioxaspiro[3.5]nonane has a molecular weight of 266.36 g/mol, XLogP of 3.40, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-7-(phenylsulfanylmethyl)-5,6,9-trioxaspiro[3.5]nonane is sourced from PubChem (CID 11323093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).