C14H18O3S — CID 11323093
7-methyl-7-(phenylsulfanylmethyl)-5,6,9-trioxaspiro[3.5]nonane (PubChem CID 11323093) has the molecular formula C14H18O3S and a molecular weight of 266.36 g/mol. Its IUPAC name is 7-methyl-7-(phenylsulfanylmethyl)-5,6,9-trioxaspiro[3.5]nonane.
| Compound Name | 7-methyl-7-(phenylsulfanylmethyl)-5,6,9-trioxaspiro[3.5]nonane |
|---|---|
| PubChem CID | 11323093 |
| Molecular Formula | C14H18O3S |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 7-methyl-7-(phenylsulfanylmethyl)-5,6,9-trioxaspiro[3.5]nonane |
| SMILES | CC1(CSc2ccccc2)COC2(CCC2)OO1 |
| InChI | InChI=1S/C14H18O3S/c1-13(11-18-12-6-3-2-4-7-12)10-15-14(17-16-13)8-5-9-14/h2-4,6-7H,5,8-11H2,1H3 |
| InChIKey | AUOVDZGSQAVVKO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|