C15H22O2S — CID 134890527
(6R)-2,2-dimethyl-4-phenylsulfanyl-6-propan-2-yl-1,3-dioxane (PubChem CID 134890527) has the molecular formula C15H22O2S and a molecular weight of 266.41 g/mol. Its IUPAC name is (6R)-2,2-dimethyl-4-phenylsulfanyl-6-propan-2-yl-1,3-dioxane.
| Compound Name | (6R)-2,2-dimethyl-4-phenylsulfanyl-6-propan-2-yl-1,3-dioxane |
|---|---|
| PubChem CID | 134890527 |
| Molecular Formula | C15H22O2S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | (6R)-2,2-dimethyl-4-phenylsulfanyl-6-propan-2-yl-1,3-dioxane |
| SMILES | CC(C)[C@H]1CC(Sc2ccccc2)OC(C)(C)O1 |
| InChI | InChI=1S/C15H22O2S/c1-11(2)13-10-14(17-15(3,4)16-13)18-12-8-6-5-7-9-12/h5-9,11,13-14H,10H2,1-4H3/t13-,14?/m1/s1 |
| InChIKey | CLURWLNGIBYOAJ-KWCCSABGSA-N |
| XLogP | 4.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |