C16H24O4S — CID 10567116
(4S)-4-(benzenesulfonylmethyl)-2,2,4,6,6-pentamethyl-1,3-dioxane (PubChem CID 10567116) has the molecular formula C16H24O4S and a molecular weight of 312.43 g/mol. Its IUPAC name is (4S)-4-(benzenesulfonylmethyl)-2,2,4,6,6-pentamethyl-1,3-dioxane.
| Compound Name | (4S)-4-(benzenesulfonylmethyl)-2,2,4,6,6-pentamethyl-1,3-dioxane |
|---|---|
| PubChem CID | 10567116 |
| Molecular Formula | C16H24O4S |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | (4S)-4-(benzenesulfonylmethyl)-2,2,4,6,6-pentamethyl-1,3-dioxane |
| SMILES | CC1(C)C[C@@](C)(CS(=O)(=O)c2ccccc2)OC(C)(C)O1 |
| InChI | InChI=1S/C16H24O4S/c1-14(2)11-16(5,20-15(3,4)19-14)12-21(17,18)13-9-7-6-8-10-13/h6-10H,11-12H2,1-5H3/t16-/m0/s1 |
| InChIKey | GYSFZNQEJLPXMM-INIZCTEOSA-N |
| XLogP | 3.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |