C13H20O4S — CID 10730903
(2S)-1-(benzenesulfonyl)-2,4-dimethylpentane-2,4-diol (PubChem CID 10730903) has the molecular formula C13H20O4S and a molecular weight of 272.37 g/mol. Its IUPAC name is (2S)-1-(benzenesulfonyl)-2,4-dimethylpentane-2,4-diol.
| Compound Name | (2S)-1-(benzenesulfonyl)-2,4-dimethylpentane-2,4-diol |
|---|---|
| PubChem CID | 10730903 |
| Molecular Formula | C13H20O4S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | (2S)-1-(benzenesulfonyl)-2,4-dimethylpentane-2,4-diol |
| SMILES | CC(C)(O)C[C@](C)(O)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H20O4S/c1-12(2,14)9-13(3,15)10-18(16,17)11-7-5-4-6-8-11/h4-8,14-15H,9-10H2,1-3H3/t13-/m0/s1 |
| InChIKey | FSCYHESCJQLOHV-ZDUSSCGKSA-N |
| XLogP | 1.37 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |