C15H24O4S — CID 10425254
[(2R,3S)-3-(methoxymethoxy)-2,4-dimethylpentyl]sulfonylbenzene (PubChem CID 10425254) has the molecular formula C15H24O4S and a molecular weight of 300.42 g/mol. Its IUPAC name is [(2R,3S)-3-(methoxymethoxy)-2,4-dimethylpentyl]sulfonylbenzene.
| Compound Name | [(2R,3S)-3-(methoxymethoxy)-2,4-dimethylpentyl]sulfonylbenzene |
|---|---|
| PubChem CID | 10425254 |
| Molecular Formula | C15H24O4S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | [(2R,3S)-3-(methoxymethoxy)-2,4-dimethylpentyl]sulfonylbenzene |
| SMILES | COCO[C@@H](C(C)C)[C@@H](C)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H24O4S/c1-12(2)15(19-11-18-4)13(3)10-20(16,17)14-8-6-5-7-9-14/h5-9,12-13,15H,10-11H2,1-4H3/t13-,15-/m0/s1 |
| InChIKey | ABJQJIMEUNAHRZ-ZFWWWQNUSA-N |
| XLogP | 2.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|