C14H20O4S — CID 11847238
(2S,3R,4S,5R)-3,4,5-trimethoxy-2-phenylsulfanyloxane (PubChem CID 11847238) has the molecular formula C14H20O4S and a molecular weight of 284.38 g/mol. Its IUPAC name is (2S,3R,4S,5R)-3,4,5-trimethoxy-2-phenylsulfanyloxane.
| Compound Name | (2S,3R,4S,5R)-3,4,5-trimethoxy-2-phenylsulfanyloxane |
|---|---|
| PubChem CID | 11847238 |
| Molecular Formula | C14H20O4S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | (2S,3R,4S,5R)-3,4,5-trimethoxy-2-phenylsulfanyloxane |
| SMILES | CO[C@@H]1[C@@H](OC)[C@H](Sc2ccccc2)OC[C@H]1OC |
| InChI | InChI=1S/C14H20O4S/c1-15-11-9-18-14(13(17-3)12(11)16-2)19-10-7-5-4-6-8-10/h4-8,11-14H,9H2,1-3H3/t11-,12+,13-,14+/m1/s1 |
| InChIKey | JMEGWEXWXSXPQS-RQJABVFESA-N |
| XLogP | 2.18 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |