C16H20O4S — CID 11312870
3-methyl-3-(phenylsulfanylmethyl)-1,2,5-trioxaspiro[5.5]undecan-9-one (PubChem CID 11312870) has the molecular formula C16H20O4S and a molecular weight of 308.40 g/mol. Its IUPAC name is 3-methyl-3-(phenylsulfanylmethyl)-1,2,5-trioxaspiro[5.5]undecan-9-one.
| Compound Name | 3-methyl-3-(phenylsulfanylmethyl)-1,2,5-trioxaspiro[5.5]undecan-9-one |
|---|---|
| PubChem CID | 11312870 |
| Molecular Formula | C16H20O4S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 3-methyl-3-(phenylsulfanylmethyl)-1,2,5-trioxaspiro[5.5]undecan-9-one |
| SMILES | CC1(CSc2ccccc2)COC2(CCC(=O)CC2)OO1 |
| InChI | InChI=1S/C16H20O4S/c1-15(12-21-14-5-3-2-4-6-14)11-18-16(20-19-15)9-7-13(17)8-10-16/h2-6H,7-12H2,1H3 |
| InChIKey | IJWKYINCZFKBGH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|