C17H22O4S — CID 102161094
[(2S,3S,6S)-2-methyl-6-phenylsulfanyloxan-3-yl] 4-oxopentanoate (PubChem CID 102161094) has the molecular formula C17H22O4S and a molecular weight of 322.43 g/mol. Its IUPAC name is [(2S,3S,6S)-2-methyl-6-phenylsulfanyloxan-3-yl] 4-oxopentanoate.
| Compound Name | [(2S,3S,6S)-2-methyl-6-phenylsulfanyloxan-3-yl] 4-oxopentanoate |
|---|---|
| PubChem CID | 102161094 |
| Molecular Formula | C17H22O4S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | [(2S,3S,6S)-2-methyl-6-phenylsulfanyloxan-3-yl] 4-oxopentanoate |
| SMILES | CC(=O)CCC(=O)O[C@H]1CC[C@H](Sc2ccccc2)O[C@H]1C |
| InChI | InChI=1S/C17H22O4S/c1-12(18)8-10-16(19)21-15-9-11-17(20-13(15)2)22-14-6-4-3-5-7-14/h3-7,13,15,17H,8-11H2,1-2H3/t13-,15-,17-/m0/s1 |
| InChIKey | OEJKRGGQWQTUGR-QRTARXTBSA-N |
| XLogP | 3.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |