C16H18O6S — CID 16748039
[(2R,3R,4R)-3-acetyloxy-6-oxo-4-phenylsulfanyloxan-2-yl]methyl acetate (PubChem CID 16748039) has the molecular formula C16H18O6S and a molecular weight of 338.38 g/mol. Its IUPAC name is [(2R,3R,4R)-3-acetyloxy-6-oxo-4-phenylsulfanyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R)-3-acetyloxy-6-oxo-4-phenylsulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 16748039 |
| Molecular Formula | C16H18O6S |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | [(2R,3R,4R)-3-acetyloxy-6-oxo-4-phenylsulfanyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(=O)C[C@@H](Sc2ccccc2)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C16H18O6S/c1-10(17)20-9-13-16(21-11(2)18)14(8-15(19)22-13)23-12-6-4-3-5-7-12/h3-7,13-14,16H,8-9H2,1-2H3/t13-,14-,16-/m1/s1 |
| InChIKey | DGIBYEQEJOBPLI-IIAWOOMASA-N |
| XLogP | 1.96 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|