C31H49ClO5S — CID 71598224
3,3-bis(4-tert-butylcyclohexyl)-6-[(4-chlorophenyl)sulfonylmethyl]-6-methyl-1,2,4-trioxane (PubChem CID 71598224) has the molecular formula C31H49ClO5S and a molecular weight of 569.25 g/mol. Its IUPAC name is 3,3-bis(4-tert-butylcyclohexyl)-6-[(4-chlorophenyl)sulfonylmethyl]-6-methyl-1,2,4-trioxane.
| Compound Name | 3,3-bis(4-tert-butylcyclohexyl)-6-[(4-chlorophenyl)sulfonylmethyl]-6-methyl-1,2,4-trioxane |
|---|---|
| PubChem CID | 71598224 |
| Molecular Formula | C31H49ClO5S |
| Molecular Weight | 569.25 g/mol |
| Exact Mass | 568.30 |
| IUPAC Name | 3,3-bis(4-tert-butylcyclohexyl)-6-[(4-chlorophenyl)sulfonylmethyl]-6-methyl-1,2,4-trioxane |
| SMILES | CC1(CS(=O)(=O)c2ccc(Cl)cc2)COC(C2CCC(C(C)(C)C)CC2)(C2CCC(C(C)(C)C)CC2)OO1 |
| InChI | InChI=1S/C31H49ClO5S/c1-28(2,3)22-8-12-24(13-9-22)31(25-14-10-23(11-15-25)29(4,5)6)35-20-30(7,36-37-31)21-38(33,34)27-18-16-26(32)17-19-27/h16-19,22-25H,8-15,20-21H2,1-7H3 |
| InChIKey | UNGFTKDMKSDPTJ-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.25 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|