C19H20O3S — CID 134928793
7-phenyl-7-(phenylsulfanylmethyl)-5,6,9-trioxaspiro[3.5]nonane (PubChem CID 134928793) has the molecular formula C19H20O3S and a molecular weight of 328.43 g/mol. Its IUPAC name is 7-phenyl-7-(phenylsulfanylmethyl)-5,6,9-trioxaspiro[3.5]nonane.
| Compound Name | 7-phenyl-7-(phenylsulfanylmethyl)-5,6,9-trioxaspiro[3.5]nonane |
|---|---|
| PubChem CID | 134928793 |
| Molecular Formula | C19H20O3S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 7-phenyl-7-(phenylsulfanylmethyl)-5,6,9-trioxaspiro[3.5]nonane |
| SMILES | c1ccc(SCC2(c3ccccc3)COC3(CCC3)OO2)cc1 |
| InChI | InChI=1S/C19H20O3S/c1-3-8-16(9-4-1)18(15-23-17-10-5-2-6-11-17)14-20-19(22-21-18)12-7-13-19/h1-6,8-11H,7,12-15H2 |
| InChIKey | FQNVUKUHWDNRNZ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|