C20H22O3S — CID 101349117
8-phenyl-8-(phenylsulfanylmethyl)-6,7,10-trioxaspiro[4.5]decane (PubChem CID 101349117) has the molecular formula C20H22O3S and a molecular weight of 342.46 g/mol. Its IUPAC name is 8-phenyl-8-(phenylsulfanylmethyl)-6,7,10-trioxaspiro[4.5]decane.
| Compound Name | 8-phenyl-8-(phenylsulfanylmethyl)-6,7,10-trioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 101349117 |
| Molecular Formula | C20H22O3S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 8-phenyl-8-(phenylsulfanylmethyl)-6,7,10-trioxaspiro[4.5]decane |
| SMILES | c1ccc(SCC2(c3ccccc3)COC3(CCCC3)OO2)cc1 |
| InChI | InChI=1S/C20H22O3S/c1-3-9-17(10-4-1)19(16-24-18-11-5-2-6-12-18)15-21-20(23-22-19)13-7-8-14-20/h1-6,9-12H,7-8,13-16H2 |
| InChIKey | OLUBYWWKRVYOEN-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|