C25H32O3S — CID 134928286
9-tert-butyl-3-phenyl-3-(phenylsulfanylmethyl)-1,2,5-trioxaspiro[5.5]undecane (PubChem CID 134928286) has the molecular formula C25H32O3S and a molecular weight of 412.60 g/mol. Its IUPAC name is 9-tert-butyl-3-phenyl-3-(phenylsulfanylmethyl)-1,2,5-trioxaspiro[5.5]undecane.
| Compound Name | 9-tert-butyl-3-phenyl-3-(phenylsulfanylmethyl)-1,2,5-trioxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 134928286 |
| Molecular Formula | C25H32O3S |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 9-tert-butyl-3-phenyl-3-(phenylsulfanylmethyl)-1,2,5-trioxaspiro[5.5]undecane |
| SMILES | CC(C)(C)C1CCC2(CC1)OCC(CSc1ccccc1)(c1ccccc1)OO2 |
| InChI | InChI=1S/C25H32O3S/c1-23(2,3)20-14-16-25(17-15-20)26-18-24(27-28-25,21-10-6-4-7-11-21)19-29-22-12-8-5-9-13-22/h4-13,20H,14-19H2,1-3H3 |
| InChIKey | UGLKKIXVZYFLFI-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|