C28H30O2S — CID 138983364
(2R,3R,4S,7S)-2,3,4-trimethyl-1,5-diphenyl-7-(phenylsulfanylmethyl)-6,8-dioxabicyclo[3.2.1]octane (PubChem CID 138983364) has the molecular formula C28H30O2S and a molecular weight of 430.61 g/mol. Its IUPAC name is (2R,3R,4S,7S)-2,3,4-trimethyl-1,5-diphenyl-7-(phenylsulfanylmethyl)-6,8-dioxabicyclo[3.2.1]octane.
| Compound Name | (2R,3R,4S,7S)-2,3,4-trimethyl-1,5-diphenyl-7-(phenylsulfanylmethyl)-6,8-dioxabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 138983364 |
| Molecular Formula | C28H30O2S |
| Molecular Weight | 430.61 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | (2R,3R,4S,7S)-2,3,4-trimethyl-1,5-diphenyl-7-(phenylsulfanylmethyl)-6,8-dioxabicyclo[3.2.1]octane |
| SMILES | C[C@@H]1[C@@H](C)C2(c3ccccc3)OC(c3ccccc3)(O[C@@H]2CSc2ccccc2)[C@H]1C |
| InChI | InChI=1S/C28H30O2S/c1-20-21(2)27(23-13-7-4-8-14-23)26(19-31-25-17-11-6-12-18-25)29-28(30-27,22(20)3)24-15-9-5-10-16-24/h4-18,20-22,26H,19H2,1-3H3/t20-,21-,22+,26-,27?,28?/m1/s1 |
| InChIKey | HGTRHKPGEFYFHV-CZJSPVSNSA-N |
| XLogP | 6.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.61 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |