C21H24O3S — CID 101349118
3-phenyl-3-(phenylsulfanylmethyl)-1,2,5-trioxaspiro[5.5]undecane (PubChem CID 101349118) has the molecular formula C21H24O3S and a molecular weight of 356.49 g/mol. Its IUPAC name is 3-phenyl-3-(phenylsulfanylmethyl)-1,2,5-trioxaspiro[5.5]undecane.
| Compound Name | 3-phenyl-3-(phenylsulfanylmethyl)-1,2,5-trioxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 101349118 |
| Molecular Formula | C21H24O3S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 3-phenyl-3-(phenylsulfanylmethyl)-1,2,5-trioxaspiro[5.5]undecane |
| SMILES | c1ccc(SCC2(c3ccccc3)COC3(CCCCC3)OO2)cc1 |
| InChI | InChI=1S/C21H24O3S/c1-4-10-18(11-5-1)20(17-25-19-12-6-2-7-13-19)16-22-21(24-23-20)14-8-3-9-15-21/h1-2,4-7,10-13H,3,8-9,14-17H2 |
| InChIKey | RGDULNWCXJDIJR-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|