C29H30O3S2 — CID 102408093
(3aS,4S,7aS)-2,2-dimethyl-6-methylsulfanyl-4-(trityloxymethyl)-4,7a-dihydro-3aH-thiopyrano[3,4-d][1,3]dioxole (PubChem CID 102408093) has the molecular formula C29H30O3S2 and a molecular weight of 490.69 g/mol. Its IUPAC name is (3aS,4S,7aS)-2,2-dimethyl-6-methylsulfanyl-4-(trityloxymethyl)-4,7a-dihydro-3aH-thiopyrano[3,4-d][1,3]dioxole.
| Compound Name | (3aS,4S,7aS)-2,2-dimethyl-6-methylsulfanyl-4-(trityloxymethyl)-4,7a-dihydro-3aH-thiopyrano[3,4-d][1,3]dioxole |
|---|---|
| PubChem CID | 102408093 |
| Molecular Formula | C29H30O3S2 |
| Molecular Weight | 490.69 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | (3aS,4S,7aS)-2,2-dimethyl-6-methylsulfanyl-4-(trityloxymethyl)-4,7a-dihydro-3aH-thiopyrano[3,4-d][1,3]dioxole |
| SMILES | CSC1=C[C@@H]2OC(C)(C)O[C@@H]2[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)S1 |
| InChI | InChI=1S/C29H30O3S2/c1-28(2)31-24-19-26(33-3)34-25(27(24)32-28)20-30-29(21-13-7-4-8-14-21,22-15-9-5-10-16-22)23-17-11-6-12-18-23/h4-19,24-25,27H,20H2,1-3H3/t24-,25-,27-/m0/s1 |
| InChIKey | HHZQFXRZJIGVRP-KLJDGLGGSA-N |
| XLogP | 6.84 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.69 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|