C32H32O3S — CID 101011550
[(4R,5R)-5-[methoxy(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-diphenylmethanethiol (PubChem CID 101011550) has the molecular formula C32H32O3S and a molecular weight of 496.67 g/mol. Its IUPAC name is [(4R,5R)-5-[methoxy(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-diphenylmethanethiol.
| Compound Name | [(4R,5R)-5-[methoxy(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-diphenylmethanethiol |
|---|---|
| PubChem CID | 101011550 |
| Molecular Formula | C32H32O3S |
| Molecular Weight | 496.67 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | [(4R,5R)-5-[methoxy(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-diphenylmethanethiol |
| SMILES | COC(c1ccccc1)(c1ccccc1)[C@@H]1OC(C)(C)O[C@H]1C(S)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H32O3S/c1-30(2)34-28(31(33-3,24-16-8-4-9-17-24)25-18-10-5-11-19-25)29(35-30)32(36,26-20-12-6-13-21-26)27-22-14-7-15-23-27/h4-23,28-29,36H,1-3H3/t28-,29-/m1/s1 |
| InChIKey | SKATXSGFKHEILS-FQLXRVMXSA-N |
| XLogP | 6.97 |
| TPSA | 27.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.67 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|