C28H38O3S — CID 135019233
(4S)-2,2-dimethyl-4-(phenylmethoxymethyl)-5-[(Z,1R)-1-phenylsulfanylnon-2-enyl]-1,3-dioxolane (PubChem CID 135019233) has the molecular formula C28H38O3S and a molecular weight of 454.68 g/mol. Its IUPAC name is (4S)-2,2-dimethyl-4-(phenylmethoxymethyl)-5-[(Z,1R)-1-phenylsulfanylnon-2-enyl]-1,3-dioxolane.
| Compound Name | (4S)-2,2-dimethyl-4-(phenylmethoxymethyl)-5-[(Z,1R)-1-phenylsulfanylnon-2-enyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 135019233 |
| Molecular Formula | C28H38O3S |
| Molecular Weight | 454.68 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | (4S)-2,2-dimethyl-4-(phenylmethoxymethyl)-5-[(Z,1R)-1-phenylsulfanylnon-2-enyl]-1,3-dioxolane |
| SMILES | CCCCCC/C=C\[C@@H](Sc1ccccc1)C1OC(C)(C)O[C@H]1COCc1ccccc1 |
| InChI | InChI=1S/C28H38O3S/c1-4-5-6-7-8-15-20-26(32-24-18-13-10-14-19-24)27-25(30-28(2,3)31-27)22-29-21-23-16-11-9-12-17-23/h9-20,25-27H,4-8,21-22H2,1-3H3/b20-15-/t25-,26+,27?/m0/s1 |
| InChIKey | AFLQVYSWIYQWOT-FTTNFWNGSA-N |
| XLogP | 7.41 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.68 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|