C20H21ClO3S — CID 134928665
8-[(4-chlorophenyl)sulfanylmethyl]-8-phenyl-6,7,10-trioxaspiro[4.5]decane (PubChem CID 134928665) has the molecular formula C20H21ClO3S and a molecular weight of 376.90 g/mol. Its IUPAC name is 8-[(4-chlorophenyl)sulfanylmethyl]-8-phenyl-6,7,10-trioxaspiro[4.5]decane.
| Compound Name | 8-[(4-chlorophenyl)sulfanylmethyl]-8-phenyl-6,7,10-trioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 134928665 |
| Molecular Formula | C20H21ClO3S |
| Molecular Weight | 376.90 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 8-[(4-chlorophenyl)sulfanylmethyl]-8-phenyl-6,7,10-trioxaspiro[4.5]decane |
| SMILES | Clc1ccc(SCC2(c3ccccc3)COC3(CCCC3)OO2)cc1 |
| InChI | InChI=1S/C20H21ClO3S/c21-17-8-10-18(11-9-17)25-15-19(16-6-2-1-3-7-16)14-22-20(24-23-19)12-4-5-13-20/h1-3,6-11H,4-5,12-15H2 |
| InChIKey | RULZOPOFNHIQLJ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.90 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|