C10H11ClO2S — CID 122225040
2-(4-chlorophenyl)sulfanyl-1,4-dioxane (PubChem CID 122225040) has the molecular formula C10H11ClO2S and a molecular weight of 230.72 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-1,4-dioxane.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-1,4-dioxane |
|---|---|
| PubChem CID | 122225040 |
| Molecular Formula | C10H11ClO2S |
| Molecular Weight | 230.72 g/mol |
| Exact Mass | 230.02 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-1,4-dioxane |
| SMILES | Clc1ccc(SC2COCCO2)cc1 |
| InChI | InChI=1S/C10H11ClO2S/c11-8-1-3-9(4-2-8)14-10-7-12-5-6-13-10/h1-4,10H,5-7H2 |
| InChIKey | SWFHCLHGOJYHCA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.72 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |