C22H32O5S — CID 11327296
(2S)-6-[1-(benzenesulfonyl)-2-methylpropan-2-yl]-2-[[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]methyl]-3,4-dihydro-2H-pyran (PubChem CID 11327296) has the molecular formula C22H32O5S and a molecular weight of 408.56 g/mol. Its IUPAC name is (2S)-6-[1-(benzenesulfonyl)-2-methylpropan-2-yl]-2-[[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]methyl]-3,4-dihydro-2H-pyran.
| Compound Name | (2S)-6-[1-(benzenesulfonyl)-2-methylpropan-2-yl]-2-[[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]methyl]-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 11327296 |
| Molecular Formula | C22H32O5S |
| Molecular Weight | 408.56 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | (2S)-6-[1-(benzenesulfonyl)-2-methylpropan-2-yl]-2-[[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]methyl]-3,4-dihydro-2H-pyran |
| SMILES | C[C@H]1OC(C)(C)O[C@@H]1C[C@@H]1CCC=C(C(C)(C)CS(=O)(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C22H32O5S/c1-16-19(27-22(4,5)26-16)14-17-10-9-13-20(25-17)21(2,3)15-28(23,24)18-11-7-6-8-12-18/h6-8,11-13,16-17,19H,9-10,14-15H2,1-5H3/t16-,17+,19-/m1/s1 |
| InChIKey | BCYMNJJRFURJNS-ZIFCJYIRSA-N |
| XLogP | 4.48 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.56 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |