C20H32O4S — CID 135050252
2-[2-(benzenesulfonyl)decyl]-2-methyl-1,3-dioxolane (PubChem CID 135050252) has the molecular formula C20H32O4S and a molecular weight of 368.54 g/mol. Its IUPAC name is 2-[2-(benzenesulfonyl)decyl]-2-methyl-1,3-dioxolane.
| Compound Name | 2-[2-(benzenesulfonyl)decyl]-2-methyl-1,3-dioxolane |
|---|---|
| PubChem CID | 135050252 |
| Molecular Formula | C20H32O4S |
| Molecular Weight | 368.54 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 2-[2-(benzenesulfonyl)decyl]-2-methyl-1,3-dioxolane |
| SMILES | CCCCCCCCC(CC1(C)OCCO1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H32O4S/c1-3-4-5-6-7-9-14-19(17-20(2)23-15-16-24-20)25(21,22)18-12-10-8-11-13-18/h8,10-13,19H,3-7,9,14-17H2,1-2H3 |
| InChIKey | WIHZQJTWPGHCBA-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.54 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|