C21H34O4S — CID 134879378
2-[10-(benzenesulfinyl)-10-methoxydecyl]-2-methyl-1,3-dioxolane (PubChem CID 134879378) has the molecular formula C21H34O4S and a molecular weight of 382.57 g/mol. Its IUPAC name is 2-[10-(benzenesulfinyl)-10-methoxydecyl]-2-methyl-1,3-dioxolane.
| Compound Name | 2-[10-(benzenesulfinyl)-10-methoxydecyl]-2-methyl-1,3-dioxolane |
|---|---|
| PubChem CID | 134879378 |
| Molecular Formula | C21H34O4S |
| Molecular Weight | 382.57 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | 2-[10-(benzenesulfinyl)-10-methoxydecyl]-2-methyl-1,3-dioxolane |
| SMILES | COC(CCCCCCCCCC1(C)OCCO1)S(=O)c1ccccc1 |
| InChI | InChI=1S/C21H34O4S/c1-21(24-17-18-25-21)16-12-7-5-3-4-6-11-15-20(23-2)26(22)19-13-9-8-10-14-19/h8-10,13-14,20H,3-7,11-12,15-18H2,1-2H3 |
| InChIKey | GAMVDNXCFGJNHT-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.57 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|