C13H19NO2 — CID 10846631
5-ethoxy-2-[(4-methylphenyl)methyl]-1,2-oxazolidine (PubChem CID 10846631) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 5-ethoxy-2-[(4-methylphenyl)methyl]-1,2-oxazolidine.
| Compound Name | 5-ethoxy-2-[(4-methylphenyl)methyl]-1,2-oxazolidine |
|---|---|
| PubChem CID | 10846631 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 5-ethoxy-2-[(4-methylphenyl)methyl]-1,2-oxazolidine |
| SMILES | CCOC1CCN(Cc2ccc(C)cc2)O1 |
| InChI | InChI=1S/C13H19NO2/c1-3-15-13-8-9-14(16-13)10-12-6-4-11(2)5-7-12/h4-7,13H,3,8-10H2,1-2H3 |
| InChIKey | KQTSDOKZOATVQV-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |