C16H23NO4 — CID 15399965
(2R,3aR,4R,6S)-2,6-diethoxy-4-phenyl-2,3,3a,4,5,6-hexahydro-[1,2]oxazolo[2,3-b]oxazine (PubChem CID 15399965) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is (2R,3aR,4R,6S)-2,6-diethoxy-4-phenyl-2,3,3a,4,5,6-hexahydro-[1,2]oxazolo[2,3-b]oxazine.
| Compound Name | (2R,3aR,4R,6S)-2,6-diethoxy-4-phenyl-2,3,3a,4,5,6-hexahydro-[1,2]oxazolo[2,3-b]oxazine |
|---|---|
| PubChem CID | 15399965 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | (2R,3aR,4R,6S)-2,6-diethoxy-4-phenyl-2,3,3a,4,5,6-hexahydro-[1,2]oxazolo[2,3-b]oxazine |
| SMILES | CCO[C@H]1C[C@@H]2[C@@H](c3ccccc3)C[C@@H](OCC)ON2O1 |
| InChI | InChI=1S/C16H23NO4/c1-3-18-15-10-13(12-8-6-5-7-9-12)14-11-16(19-4-2)21-17(14)20-15/h5-9,13-16H,3-4,10-11H2,1-2H3/t13-,14-,15+,16-/m1/s1 |
| InChIKey | KXIKGORKSOIIOB-LVQVYYBASA-N |
| XLogP | 2.84 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |