C21H19NOS — CID 134938194
(3R,5R)-2,3-diphenyl-5-phenylsulfanyl-1,2-oxazolidine (PubChem CID 134938194) has the molecular formula C21H19NOS and a molecular weight of 333.46 g/mol. Its IUPAC name is (3R,5R)-2,3-diphenyl-5-phenylsulfanyl-1,2-oxazolidine.
| Compound Name | (3R,5R)-2,3-diphenyl-5-phenylsulfanyl-1,2-oxazolidine |
|---|---|
| PubChem CID | 134938194 |
| Molecular Formula | C21H19NOS |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | (3R,5R)-2,3-diphenyl-5-phenylsulfanyl-1,2-oxazolidine |
| SMILES | c1ccc(S[C@@H]2C[C@H](c3ccccc3)N(c3ccccc3)O2)cc1 |
| InChI | InChI=1S/C21H19NOS/c1-4-10-17(11-5-1)20-16-21(24-19-14-8-3-9-15-19)23-22(20)18-12-6-2-7-13-18/h1-15,20-21H,16H2/t20-,21-/m1/s1 |
| InChIKey | MYNTVRODWYPVBT-NHCUHLMSSA-N |
| XLogP | 5.69 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |