C21H18OS — CID 164681206
(2S,4S)-4-phenyl-2-phenylsulfanyl-3,4-dihydro-2H-chromene (PubChem CID 164681206) has the molecular formula C21H18OS and a molecular weight of 318.44 g/mol. Its IUPAC name is (2S,4S)-4-phenyl-2-phenylsulfanyl-3,4-dihydro-2H-chromene.
| Compound Name | (2S,4S)-4-phenyl-2-phenylsulfanyl-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 164681206 |
| Molecular Formula | C21H18OS |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | (2S,4S)-4-phenyl-2-phenylsulfanyl-3,4-dihydro-2H-chromene |
| SMILES | c1ccc(S[C@H]2C[C@@H](c3ccccc3)c3ccccc3O2)cc1 |
| InChI | InChI=1S/C21H18OS/c1-3-9-16(10-4-1)19-15-21(23-17-11-5-2-6-12-17)22-20-14-8-7-13-18(19)20/h1-14,19,21H,15H2/t19-,21-/m0/s1 |
| InChIKey | HDNSVQXQKSNHNK-FPOVZHCZSA-N |
| XLogP | 5.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |