C22H24O2S — CID 101085084
(6S,6aR,7aR,11aR,12aR)-6-phenylsulfanyl-6,6a,7,7a,8,9,10,11,11a,12a-decahydrochromeno[3,2-c]chromene (PubChem CID 101085084) has the molecular formula C22H24O2S and a molecular weight of 352.50 g/mol. Its IUPAC name is (6S,6aR,7aR,11aR,12aR)-6-phenylsulfanyl-6,6a,7,7a,8,9,10,11,11a,12a-decahydrochromeno[3,2-c]chromene.
| Compound Name | (6S,6aR,7aR,11aR,12aR)-6-phenylsulfanyl-6,6a,7,7a,8,9,10,11,11a,12a-decahydrochromeno[3,2-c]chromene |
|---|---|
| PubChem CID | 101085084 |
| Molecular Formula | C22H24O2S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | (6S,6aR,7aR,11aR,12aR)-6-phenylsulfanyl-6,6a,7,7a,8,9,10,11,11a,12a-decahydrochromeno[3,2-c]chromene |
| SMILES | c1ccc(S[C@@H]2Oc3ccccc3[C@@H]3O[C@@H]4CCCC[C@@H]4C[C@@H]23)cc1 |
| InChI | InChI=1S/C22H24O2S/c1-2-9-16(10-3-1)25-22-18-14-15-8-4-6-12-19(15)23-21(18)17-11-5-7-13-20(17)24-22/h1-3,5,7,9-11,13,15,18-19,21-22H,4,6,8,12,14H2/t15-,18-,19-,21+,22+/m1/s1 |
| InChIKey | UXDBKTOAQXPCRU-UFTMSNCASA-N |
| XLogP | 5.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |