C17H21NO — CID 102483395
3-[(3aR,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-2-yl]-1-methylindole (PubChem CID 102483395) has the molecular formula C17H21NO and a molecular weight of 255.36 g/mol. Its IUPAC name is 3-[(3aR,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-2-yl]-1-methylindole.
| Compound Name | 3-[(3aR,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-2-yl]-1-methylindole |
|---|---|
| PubChem CID | 102483395 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 3-[(3aR,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-2-yl]-1-methylindole |
| SMILES | Cn1cc(C2C[C@H]3CCCC[C@@H]3O2)c2ccccc21 |
| InChI | InChI=1S/C17H21NO/c1-18-11-14(13-7-3-4-8-15(13)18)17-10-12-6-2-5-9-16(12)19-17/h3-4,7-8,11-12,16-17H,2,5-6,9-10H2,1H3/t12-,16+,17?/m1/s1 |
| InChIKey | WOWFHIKHQUPOFG-KOEKDOOYSA-N |
| XLogP | 4.20 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |