C17H16N2O — CID 116837230
3-(1-methylindol-3-yl)-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 116837230) has the molecular formula C17H16N2O and a molecular weight of 264.33 g/mol. Its IUPAC name is 3-(1-methylindol-3-yl)-3,4-dihydro-2H-1,4-benzoxazine.
| Compound Name | 3-(1-methylindol-3-yl)-3,4-dihydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 116837230 |
| Molecular Formula | C17H16N2O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 3-(1-methylindol-3-yl)-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | Cn1cc(C2COc3ccccc3N2)c2ccccc21 |
| InChI | InChI=1S/C17H16N2O/c1-19-10-13(12-6-2-4-8-16(12)19)15-11-20-17-9-5-3-7-14(17)18-15/h2-10,15,18H,11H2,1H3 |
| InChIKey | MOIYACLDZILNQV-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |