C20H32NO2+ — CID 101009955
4-(5-dec-9-enyl-1,3-dioxan-2-yl)-1-methylpyridin-1-ium (PubChem CID 101009955) has the molecular formula C20H32NO2+ and a molecular weight of 318.48 g/mol. Its IUPAC name is 4-(5-dec-9-enyl-1,3-dioxan-2-yl)-1-methylpyridin-1-ium.
| Compound Name | 4-(5-dec-9-enyl-1,3-dioxan-2-yl)-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 101009955 |
| Molecular Formula | C20H32NO2+ |
| Molecular Weight | 318.48 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | 4-(5-dec-9-enyl-1,3-dioxan-2-yl)-1-methylpyridin-1-ium |
| SMILES | C=CCCCCCCCCC1COC(c2cc[n+](C)cc2)OC1 |
| InChI | InChI=1S/C20H32NO2/c1-3-4-5-6-7-8-9-10-11-18-16-22-20(23-17-18)19-12-14-21(2)15-13-19/h3,12-15,18,20H,1,4-11,16-17H2,2H3/q+1 |
| InChIKey | UXHOIYOWNYSHCK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.48 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|