About 4-(5-dec-9-enyl-1,3-dioxan-2-yl)-1-methylpyridin-1-ium
4-(5-dec-9-enyl-1,3-dioxan-2-yl)-1-methylpyridin-1-ium (PubChem CID 101009955) has the molecular formula C20H32NO2+
and a molecular weight of 318.48 g/mol. Its IUPAC name is 4-(5-dec-9-enyl-1,3-dioxan-2-yl)-1-methylpyridin-1-ium.
Molecular Properties
| Compound Name | 4-(5-dec-9-enyl-1,3-dioxan-2-yl)-1-methylpyridin-1-ium |
| PubChem CID | 101009955 |
| Molecular Formula | C20H32NO2+ |
| Molecular Weight | 318.48 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | 4-(5-dec-9-enyl-1,3-dioxan-2-yl)-1-methylpyridin-1-ium |
| SMILES | C=CCCCCCCCCC1COC(c2cc[n+](C)cc2)OC1 |
| InChI | InChI=1S/C20H32NO2/c1-3-4-5-6-7-8-9-10-11-18-16-22-20(23-17-18)19-12-14-21(2)15-13-19/h3,12-15,18,20H,1,4-11,16-17H2,2H3/q+1 |
| InChIKey | UXHOIYOWNYSHCK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.48 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-dec-9-enyl-1,3-dioxan-2-yl)-1-methylpyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-dec-9-enyl-1,3-dioxan-2-yl)-1-methylpyridin-1-ium?
The IUPAC name of 4-(5-dec-9-enyl-1,3-dioxan-2-yl)-1-methylpyridin-1-ium (CID 101009955) is 4-(5-dec-9-enyl-1,3-dioxan-2-yl)-1-methylpyridin-1-ium.
What is the SMILES notation for 4-(5-dec-9-enyl-1,3-dioxan-2-yl)-1-methylpyridin-1-ium?
The canonical SMILES for 4-(5-dec-9-enyl-1,3-dioxan-2-yl)-1-methylpyridin-1-ium is C=CCCCCCCCCC1COC(c2cc[n+](C)cc2)OC1.
What is the InChIKey of 4-(5-dec-9-enyl-1,3-dioxan-2-yl)-1-methylpyridin-1-ium?
The InChIKey is UXHOIYOWNYSHCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H32NO2/c1-3-4-5-6-7-8-9-10-11-18-16-22-20(23-17-18)19-12-14-21(2)15-13-19/h3,12-15,18,20H,1,4-11,16-17H2,2H3/q+1.
What are the key properties of 4-(5-dec-9-enyl-1,3-dioxan-2-yl)-1-methylpyridin-1-ium?
4-(5-dec-9-enyl-1,3-dioxan-2-yl)-1-methylpyridin-1-ium has a molecular weight of 318.48 g/mol, XLogP of 4.48, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-dec-9-enyl-1,3-dioxan-2-yl)-1-methylpyridin-1-ium is sourced from PubChem (CID 101009955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).