C32H46O3 — CID 19834759
2-[4-(4-octan-2-yloxyphenyl)phenyl]-5-oct-7-enyl-1,3-dioxane (PubChem CID 19834759) has the molecular formula C32H46O3 and a molecular weight of 478.72 g/mol. Its IUPAC name is 2-[4-(4-octan-2-yloxyphenyl)phenyl]-5-oct-7-enyl-1,3-dioxane.
| Compound Name | 2-[4-(4-octan-2-yloxyphenyl)phenyl]-5-oct-7-enyl-1,3-dioxane |
|---|---|
| PubChem CID | 19834759 |
| Molecular Formula | C32H46O3 |
| Molecular Weight | 478.72 g/mol |
| Exact Mass | 478.34 |
| IUPAC Name | 2-[4-(4-octan-2-yloxyphenyl)phenyl]-5-oct-7-enyl-1,3-dioxane |
| SMILES | C=CCCCCCCC1COC(c2ccc(-c3ccc(OC(C)CCCCCC)cc3)cc2)OC1 |
| InChI | InChI=1S/C32H46O3/c1-4-6-8-10-11-13-15-27-24-33-32(34-25-27)30-18-16-28(17-19-30)29-20-22-31(23-21-29)35-26(3)14-12-9-7-5-2/h4,16-23,26-27,32H,1,5-15,24-25H2,2-3H3 |
| InChIKey | AMDSFQFIZHZHIP-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.72 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|