C24H42O3Si — CID 140868873
(1S,2R,7S,8R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-8-cyclohexyl-1,5-dimethyl-11-oxatricyclo[6.2.1.02,6]undec-5-en-7-ol (PubChem CID 140868873) has the molecular formula C24H42O3Si and a molecular weight of 406.68 g/mol. Its IUPAC name is (1S,2R,7S,8R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-8-cyclohexyl-1,5-dimethyl-11-oxatricyclo[6.2.1.02,6]undec-5-en-7-ol.
| Compound Name | (1S,2R,7S,8R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-8-cyclohexyl-1,5-dimethyl-11-oxatricyclo[6.2.1.02,6]undec-5-en-7-ol |
|---|---|
| PubChem CID | 140868873 |
| Molecular Formula | C24H42O3Si |
| Molecular Weight | 406.68 g/mol |
| Exact Mass | 406.29 |
| IUPAC Name | (1S,2R,7S,8R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-8-cyclohexyl-1,5-dimethyl-11-oxatricyclo[6.2.1.02,6]undec-5-en-7-ol |
| SMILES | CC1=C2[C@@H](CC1)[C@]1(C)O[C@@](C3CCCCC3)(C[C@H]1O[Si](C)(C)C(C)(C)C)[C@H]2O |
| InChI | InChI=1S/C24H42O3Si/c1-16-13-14-18-20(16)21(25)24(17-11-9-8-10-12-17)15-19(23(18,5)27-24)26-28(6,7)22(2,3)4/h17-19,21,25H,8-15H2,1-7H3/t18-,19-,21+,23+,24-/m1/s1 |
| InChIKey | SJHWYJRLWYHXMV-QXASVXAKSA-N |
| XLogP | 5.98 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.68 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|