C20H34O3Si — CID 99771800
(1S,5S,9S,14R)-14-[tert-butyl(dimethyl)silyl]oxytricyclo[7.4.1.01,5]tetradecane-4,6-dione (PubChem CID 99771800) has the molecular formula C20H34O3Si and a molecular weight of 350.58 g/mol. Its IUPAC name is (1S,5S,9S,14R)-14-[tert-butyl(dimethyl)silyl]oxytricyclo[7.4.1.01,5]tetradecane-4,6-dione.
| Compound Name | (1S,5S,9S,14R)-14-[tert-butyl(dimethyl)silyl]oxytricyclo[7.4.1.01,5]tetradecane-4,6-dione |
|---|---|
| PubChem CID | 99771800 |
| Molecular Formula | C20H34O3Si |
| Molecular Weight | 350.58 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | (1S,5S,9S,14R)-14-[tert-butyl(dimethyl)silyl]oxytricyclo[7.4.1.01,5]tetradecane-4,6-dione |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H]2CCCC[C@@]13CCC(=O)[C@@H]3C(=O)CC2 |
| InChI | InChI=1S/C20H34O3Si/c1-19(2,3)24(4,5)23-18-14-8-6-7-12-20(18)13-11-16(22)17(20)15(21)10-9-14/h14,17-18H,6-13H2,1-5H3/t14-,17-,18+,20-/m0/s1 |
| InChIKey | ADPRPPLNHNZCIJ-DEYWJSPQSA-N |
| XLogP | 4.90 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.58 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|