C14H22O6Si — CID 11278465
(1'R,5'S,6'S)-5'-[tert-butyl(dimethyl)silyl]oxyspiro[1,3-dioxolane-4,3'-7-oxabicyclo[4.1.0]heptane]-2,2'-dione (PubChem CID 11278465) has the molecular formula C14H22O6Si and a molecular weight of 314.41 g/mol. Its IUPAC name is (1'R,5'S,6'S)-5'-[tert-butyl(dimethyl)silyl]oxyspiro[1,3-dioxolane-4,3'-7-oxabicyclo[4.1.0]heptane]-2,2'-dione.
| Compound Name | (1'R,5'S,6'S)-5'-[tert-butyl(dimethyl)silyl]oxyspiro[1,3-dioxolane-4,3'-7-oxabicyclo[4.1.0]heptane]-2,2'-dione |
|---|---|
| PubChem CID | 11278465 |
| Molecular Formula | C14H22O6Si |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | (1'R,5'S,6'S)-5'-[tert-butyl(dimethyl)silyl]oxyspiro[1,3-dioxolane-4,3'-7-oxabicyclo[4.1.0]heptane]-2,2'-dione |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC2(COC(=O)O2)C(=O)[C@@H]2O[C@H]12 |
| InChI | InChI=1S/C14H22O6Si/c1-13(2,3)21(4,5)20-8-6-14(7-17-12(16)19-14)11(15)10-9(8)18-10/h8-10H,6-7H2,1-5H3/t8-,9+,10+,14?/m0/s1 |
| InChIKey | RFEBTZJIEVRNOK-NOWMRDAKSA-N |
| XLogP | 2.02 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|