C14H22O7Si — CID 11404746
(1S,2R,6R,11R)-12-[tert-butyl(dimethyl)silyl]oxy-3,5,8,10,13-pentaoxatetracyclo[7.3.1.02,7.06,11]tridecan-4-one (PubChem CID 11404746) has the molecular formula C14H22O7Si and a molecular weight of 330.41 g/mol. Its IUPAC name is (1S,2R,6R,11R)-12-[tert-butyl(dimethyl)silyl]oxy-3,5,8,10,13-pentaoxatetracyclo[7.3.1.02,7.06,11]tridecan-4-one.
| Compound Name | (1S,2R,6R,11R)-12-[tert-butyl(dimethyl)silyl]oxy-3,5,8,10,13-pentaoxatetracyclo[7.3.1.02,7.06,11]tridecan-4-one |
|---|---|
| PubChem CID | 11404746 |
| Molecular Formula | C14H22O7Si |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | (1S,2R,6R,11R)-12-[tert-butyl(dimethyl)silyl]oxy-3,5,8,10,13-pentaoxatetracyclo[7.3.1.02,7.06,11]tridecan-4-one |
| SMILES | CC(C)(C)[Si](C)(C)OC1[C@H]2OC3OC4[C@H]2OC(=O)O[C@H]4[C@H]1O3 |
| InChI | InChI=1S/C14H22O7Si/c1-14(2,3)22(4,5)21-11-9-6-8-7(17-12(15)16-6)10(11)20-13(18-8)19-9/h6-11,13H,1-5H3/t6-,7-,8?,9-,10+,11?,13?/m1/s1 |
| InChIKey | ZGOSVQSNAHAVTO-YQPXCDFCSA-N |
| XLogP | 1.76 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|