C13H23NO4Si — CID 53344031
(3S,5S,6S,7S)-6-[tert-butyl(dimethyl)silyl]oxy-4,9-dioxa-1-azatricyclo[5.3.0.03,5]decan-10-one (PubChem CID 53344031) has the molecular formula C13H23NO4Si and a molecular weight of 285.42 g/mol. Its IUPAC name is (3S,5S,6S,7S)-6-[tert-butyl(dimethyl)silyl]oxy-4,9-dioxa-1-azatricyclo[5.3.0.03,5]decan-10-one.
| Compound Name | (3S,5S,6S,7S)-6-[tert-butyl(dimethyl)silyl]oxy-4,9-dioxa-1-azatricyclo[5.3.0.03,5]decan-10-one |
|---|---|
| PubChem CID | 53344031 |
| Molecular Formula | C13H23NO4Si |
| Molecular Weight | 285.42 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | (3S,5S,6S,7S)-6-[tert-butyl(dimethyl)silyl]oxy-4,9-dioxa-1-azatricyclo[5.3.0.03,5]decan-10-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H]2O[C@H]2CN2C(=O)OC[C@@H]12 |
| InChI | InChI=1S/C13H23NO4Si/c1-13(2,3)19(4,5)18-10-8-7-16-12(15)14(8)6-9-11(10)17-9/h8-11H,6-7H2,1-5H3/t8-,9-,10-,11-/m0/s1 |
| InChIKey | PQWSJIREMCYBGP-NAKRPEOUSA-N |
| XLogP | 1.98 |
| TPSA | 51.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.42 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|