C21H31NO7Si — CID 23729979
methyl (5S,10S,10aR)-10-[tert-butyl(dimethyl)silyl]oxy-7,8-dimethoxy-3-oxo-1,5,10,10a-tetrahydro-[1,3]oxazolo[3,4-b]isoquinoline-5-carboxylate (PubChem CID 23729979) has the molecular formula C21H31NO7Si and a molecular weight of 437.57 g/mol. Its IUPAC name is methyl (5S,10S,10aR)-10-[tert-butyl(dimethyl)silyl]oxy-7,8-dimethoxy-3-oxo-1,5,10,10a-tetrahydro-[1,3]oxazolo[3,4-b]isoquinoline-5-carboxylate.
| Compound Name | methyl (5S,10S,10aR)-10-[tert-butyl(dimethyl)silyl]oxy-7,8-dimethoxy-3-oxo-1,5,10,10a-tetrahydro-[1,3]oxazolo[3,4-b]isoquinoline-5-carboxylate |
|---|---|
| PubChem CID | 23729979 |
| Molecular Formula | C21H31NO7Si |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | methyl (5S,10S,10aR)-10-[tert-butyl(dimethyl)silyl]oxy-7,8-dimethoxy-3-oxo-1,5,10,10a-tetrahydro-[1,3]oxazolo[3,4-b]isoquinoline-5-carboxylate |
| SMILES | COC(=O)[C@@H]1c2cc(OC)c(OC)cc2[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2COC(=O)N12 |
| InChI | InChI=1S/C21H31NO7Si/c1-21(2,3)30(7,8)29-18-13-10-16(26-5)15(25-4)9-12(13)17(19(23)27-6)22-14(18)11-28-20(22)24/h9-10,14,17-18H,11H2,1-8H3/t14-,17+,18+/m1/s1 |
| InChIKey | SWIPPWOWQCLKCK-JLSDUUJJSA-N |
| XLogP | 3.82 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|