C23H42O9SSi2 — CID 100978939
methyl (4S,5S,6R,7R)-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methylsulfonyloxy-3-oxo-4,5,6,7-tetrahydro-1H-2-benzofuran-4-carboxylate (PubChem CID 100978939) has the molecular formula C23H42O9SSi2 and a molecular weight of 550.82 g/mol. Its IUPAC name is methyl (4S,5S,6R,7R)-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methylsulfonyloxy-3-oxo-4,5,6,7-tetrahydro-1H-2-benzofuran-4-carboxylate.
| Compound Name | methyl (4S,5S,6R,7R)-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methylsulfonyloxy-3-oxo-4,5,6,7-tetrahydro-1H-2-benzofuran-4-carboxylate |
|---|---|
| PubChem CID | 100978939 |
| Molecular Formula | C23H42O9SSi2 |
| Molecular Weight | 550.82 g/mol |
| Exact Mass | 550.21 |
| IUPAC Name | methyl (4S,5S,6R,7R)-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methylsulfonyloxy-3-oxo-4,5,6,7-tetrahydro-1H-2-benzofuran-4-carboxylate |
| SMILES | COC(=O)[C@H]1C2=C(COC2=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1OS(C)(=O)=O |
| InChI | InChI=1S/C23H42O9SSi2/c1-22(2,3)34(9,10)31-17-14-13-29-21(25)15(14)16(20(24)28-7)18(30-33(8,26)27)19(17)32-35(11,12)23(4,5)6/h16-19H,13H2,1-12H3/t16-,17+,18-,19+/m0/s1 |
| InChIKey | VGACURJRGVPLGW-ZSYWTGECSA-N |
| XLogP | 3.77 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.82 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|