C15H31NO6SSi — CID 58599575
methyl (1S,2R,5R)-2-amino-3-[tert-butyl(dimethyl)silyl]oxy-5-methylsulfonyloxycyclohexane-1-carboxylate (PubChem CID 58599575) has the molecular formula C15H31NO6SSi and a molecular weight of 381.57 g/mol. Its IUPAC name is methyl (1S,2R,5R)-2-amino-3-[tert-butyl(dimethyl)silyl]oxy-5-methylsulfonyloxycyclohexane-1-carboxylate.
| Compound Name | methyl (1S,2R,5R)-2-amino-3-[tert-butyl(dimethyl)silyl]oxy-5-methylsulfonyloxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 58599575 |
| Molecular Formula | C15H31NO6SSi |
| Molecular Weight | 381.57 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | methyl (1S,2R,5R)-2-amino-3-[tert-butyl(dimethyl)silyl]oxy-5-methylsulfonyloxycyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@@H](OS(C)(=O)=O)CC(O[Si](C)(C)C(C)(C)C)[C@@H]1N |
| InChI | InChI=1S/C15H31NO6SSi/c1-15(2,3)24(6,7)22-12-9-10(21-23(5,18)19)8-11(13(12)16)14(17)20-4/h10-13H,8-9,16H2,1-7H3/t10-,11+,12?,13-/m1/s1 |
| InChIKey | LUWZDJZKWXAFPG-ZGVCCVRISA-N |
| XLogP | 1.63 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.57 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|