C18H37NO6SSi — CID 171659990
[(1S,3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl] methanesulfonate (PubChem CID 171659990) has the molecular formula C18H37NO6SSi and a molecular weight of 423.65 g/mol. Its IUPAC name is [(1S,3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl] methanesulfonate.
| Compound Name | [(1S,3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl] methanesulfonate |
|---|---|
| PubChem CID | 171659990 |
| Molecular Formula | C18H37NO6SSi |
| Molecular Weight | 423.65 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | [(1S,3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl] methanesulfonate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC[C@H](OS(C)(=O)=O)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H37NO6SSi/c1-17(2,3)23-16(20)19-14-11-10-13(24-26(7,21)22)12-15(14)25-27(8,9)18(4,5)6/h13-15H,10-12H2,1-9H3,(H,19,20)/t13-,14+,15+/m0/s1 |
| InChIKey | QLPKSNWWLBNTBT-RRFJBIMHSA-N |
| XLogP | 3.80 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.65 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|