C15H28N2O6S — CID 58084194
[(1R,2R,4S)-4-(dimethylcarbamoyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl] methanesulfonate (PubChem CID 58084194) has the molecular formula C15H28N2O6S and a molecular weight of 364.46 g/mol. Its IUPAC name is [(1R,2R,4S)-4-(dimethylcarbamoyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl] methanesulfonate.
| Compound Name | [(1R,2R,4S)-4-(dimethylcarbamoyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl] methanesulfonate |
|---|---|
| PubChem CID | 58084194 |
| Molecular Formula | C15H28N2O6S |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | [(1R,2R,4S)-4-(dimethylcarbamoyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl] methanesulfonate |
| SMILES | CN(C)C(=O)[C@H]1CC[C@@H](OS(C)(=O)=O)[C@H](NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H28N2O6S/c1-15(2,3)22-14(19)16-11-9-10(13(18)17(4)5)7-8-12(11)23-24(6,20)21/h10-12H,7-9H2,1-6H3,(H,16,19)/t10-,11+,12+/m0/s1 |
| InChIKey | APTADHGCVGEOLE-QJPTWQEYSA-N |
| XLogP | 1.11 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|