C15H29N3O8S2 — CID 118661232
[(1R,2S,4S)-4-(dimethylcarbamoyl)-2-[(2-methylpropan-2-yl)oxycarbonylsulfamoylamino]cyclohexyl] methanesulfonate (PubChem CID 118661232) has the molecular formula C15H29N3O8S2 and a molecular weight of 443.54 g/mol. Its IUPAC name is [(1R,2S,4S)-4-(dimethylcarbamoyl)-2-[(2-methylpropan-2-yl)oxycarbonylsulfamoylamino]cyclohexyl] methanesulfonate.
| Compound Name | [(1R,2S,4S)-4-(dimethylcarbamoyl)-2-[(2-methylpropan-2-yl)oxycarbonylsulfamoylamino]cyclohexyl] methanesulfonate |
|---|---|
| PubChem CID | 118661232 |
| Molecular Formula | C15H29N3O8S2 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | [(1R,2S,4S)-4-(dimethylcarbamoyl)-2-[(2-methylpropan-2-yl)oxycarbonylsulfamoylamino]cyclohexyl] methanesulfonate |
| SMILES | CN(C)C(=O)[C@H]1CC[C@@H](OS(C)(=O)=O)[C@@H](NS(=O)(=O)NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H29N3O8S2/c1-15(2,3)25-14(20)17-28(23,24)16-11-9-10(13(19)18(4)5)7-8-12(11)26-27(6,21)22/h10-12,16H,7-9H2,1-6H3,(H,17,20)/t10-,11-,12+/m0/s1 |
| InChIKey | MSXBNKGCQBFGTC-SDDRHHMPSA-N |
| XLogP | -0.05 |
| TPSA | 148.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|