C22H31ClN4O4 — CID 68980574
tert-butyl N-[(1R,2S,5S)-2-[3-(5-chloro-2-pyridinyl)prop-2-enoylamino]-5-(dimethylcarbamoyl)cyclohexyl]carbamate (PubChem CID 68980574) has the molecular formula C22H31ClN4O4 and a molecular weight of 450.97 g/mol. Its IUPAC name is tert-butyl N-[(1R,2S,5S)-2-[3-(5-chloro-2-pyridinyl)prop-2-enoylamino]-5-(dimethylcarbamoyl)cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2S,5S)-2-[3-(5-chloro-2-pyridinyl)prop-2-enoylamino]-5-(dimethylcarbamoyl)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 68980574 |
| Molecular Formula | C22H31ClN4O4 |
| Molecular Weight | 450.97 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | tert-butyl N-[(1R,2S,5S)-2-[3-(5-chloro-2-pyridinyl)prop-2-enoylamino]-5-(dimethylcarbamoyl)cyclohexyl]carbamate |
| SMILES | CN(C)C(=O)[C@H]1CC[C@H](NC(=O)C=Cc2ccc(Cl)cn2)[C@H](NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C22H31ClN4O4/c1-22(2,3)31-21(30)26-18-12-14(20(29)27(4)5)6-10-17(18)25-19(28)11-9-16-8-7-15(23)13-24-16/h7-9,11,13-14,17-18H,6,10,12H2,1-5H3,(H,25,28)(H,26,30)/t14-,17-,18+/m0/s1 |
| InChIKey | LQUCPYCBOBRBKM-JCGIZDLHSA-N |
| XLogP | 3.01 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.97 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|