C16H24ClN3O2 — CID 86794465
tert-butyl N-[2-[(5-chloro-2-pyridinyl)methylamino]cyclopentyl]carbamate (PubChem CID 86794465) has the molecular formula C16H24ClN3O2 and a molecular weight of 325.84 g/mol. Its IUPAC name is tert-butyl N-[2-[(5-chloro-2-pyridinyl)methylamino]cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[2-[(5-chloro-2-pyridinyl)methylamino]cyclopentyl]carbamate |
|---|---|
| PubChem CID | 86794465 |
| Molecular Formula | C16H24ClN3O2 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | tert-butyl N-[2-[(5-chloro-2-pyridinyl)methylamino]cyclopentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCCC1NCc1ccc(Cl)cn1 |
| InChI | InChI=1S/C16H24ClN3O2/c1-16(2,3)22-15(21)20-14-6-4-5-13(14)19-10-12-8-7-11(17)9-18-12/h7-9,13-14,19H,4-6,10H2,1-3H3,(H,20,21) |
| InChIKey | JOUJQYFLIIHUSD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |